C23H28ClN5O3 — CID 43004881
5-chloro-N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-3-methyl-1-[(4-methylphenyl)methyl]pyrazole-4-carboxamide (PubChem CID 43004881) has the molecular formula C23H28ClN5O3 and a molecular weight of 457.96 g/mol. Its IUPAC name is 5-chloro-N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-3-methyl-1-[(4-methylphenyl)methyl]pyrazole-4-carboxamide.
| Compound Name | 5-chloro-N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-3-methyl-1-[(4-methylphenyl)methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 43004881 |
| Molecular Formula | C23H28ClN5O3 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 5-chloro-N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-3-methyl-1-[(4-methylphenyl)methyl]pyrazole-4-carboxamide |
| SMILES | Cc1ccc(Cn2nc(C)c(C(=O)NCCCN3C(=O)NC4(CCCC4)C3=O)c2Cl)cc1 |
| InChI | InChI=1S/C23H28ClN5O3/c1-15-6-8-17(9-7-15)14-29-19(24)18(16(2)27-29)20(30)25-12-5-13-28-21(31)23(26-22(28)32)10-3-4-11-23/h6-9H,3-5,10-14H2,1-2H3,(H,25,30)(H,26,32) |
| InChIKey | VYPPLPLMBXAOMY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|