C23H29N5O4 — CID 43004883
1-(2,5-dimethylphenyl)-N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-6-oxo-4,5-dihydropyridazine-3-carboxamide (PubChem CID 43004883) has the molecular formula C23H29N5O4 and a molecular weight of 439.52 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-6-oxo-4,5-dihydropyridazine-3-carboxamide.
| Compound Name | 1-(2,5-dimethylphenyl)-N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-6-oxo-4,5-dihydropyridazine-3-carboxamide |
|---|---|
| PubChem CID | 43004883 |
| Molecular Formula | C23H29N5O4 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-6-oxo-4,5-dihydropyridazine-3-carboxamide |
| SMILES | Cc1ccc(C)c(N2N=C(C(=O)NCCCN3C(=O)NC4(CCCC4)C3=O)CCC2=O)c1 |
| InChI | InChI=1S/C23H29N5O4/c1-15-6-7-16(2)18(14-15)28-19(29)9-8-17(26-28)20(30)24-12-5-13-27-21(31)23(25-22(27)32)10-3-4-11-23/h6-7,14H,3-5,8-13H2,1-2H3,(H,24,30)(H,25,32) |
| InChIKey | JFQNYUSAZGUDJF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|