C20H24N6O2 — CID 60518761
1-(2,5-dimethylphenyl)-6-oxo-N-[3-(pyrimidin-2-ylamino)propyl]-4,5-dihydropyridazine-3-carboxamide (PubChem CID 60518761) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-6-oxo-N-[3-(pyrimidin-2-ylamino)propyl]-4,5-dihydropyridazine-3-carboxamide.
| Compound Name | 1-(2,5-dimethylphenyl)-6-oxo-N-[3-(pyrimidin-2-ylamino)propyl]-4,5-dihydropyridazine-3-carboxamide |
|---|---|
| PubChem CID | 60518761 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-6-oxo-N-[3-(pyrimidin-2-ylamino)propyl]-4,5-dihydropyridazine-3-carboxamide |
| SMILES | Cc1ccc(C)c(N2N=C(C(=O)NCCCNc3ncccn3)CCC2=O)c1 |
| InChI | InChI=1S/C20H24N6O2/c1-14-5-6-15(2)17(13-14)26-18(27)8-7-16(25-26)19(28)21-9-3-10-22-20-23-11-4-12-24-20/h4-6,11-13H,3,7-10H2,1-2H3,(H,21,28)(H,22,23,24) |
| InChIKey | DZBKGBOYWXZVIE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|