C29H29N3O3 — CID 43007534
1-benzyl-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 43007534) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 1-benzyl-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-benzyl-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 43007534 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 1-benzyl-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccc(C(CNC(=O)C2CC(=O)N(Cc3ccccc3)C2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C29H29N3O3/c1-35-23-13-11-21(12-14-23)25(26-17-30-27-10-6-5-9-24(26)27)16-31-29(34)22-15-28(33)32(19-22)18-20-7-3-2-4-8-20/h2-14,17,22,25,30H,15-16,18-19H2,1H3,(H,31,34) |
| InChIKey | AGQGNTWRCBBUHE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |