C31H26N2O3 — CID 4835102
N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-9H-xanthene-9-carboxamide (PubChem CID 4835102) has the molecular formula C31H26N2O3 and a molecular weight of 474.56 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-9H-xanthene-9-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 4835102 |
| Molecular Formula | C31H26N2O3 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-9H-xanthene-9-carboxamide |
| SMILES | COc1ccc(C(CNC(=O)C2c3ccccc3Oc3ccccc32)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C31H26N2O3/c1-35-21-16-14-20(15-17-21)25(26-19-32-27-11-5-2-8-22(26)27)18-33-31(34)30-23-9-3-6-12-28(23)36-29-13-7-4-10-24(29)30/h2-17,19,25,30,32H,18H2,1H3,(H,33,34) |
| InChIKey | ISMQWHPQKHBPCP-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |