C22H24ClFN2O3S — CID 43007741
N-[4-[1-(2-bicyclo[2.2.1]heptanyl)ethylsulfamoyl]phenyl]-2-chloro-4-fluorobenzamide (PubChem CID 43007741) has the molecular formula C22H24ClFN2O3S and a molecular weight of 450.96 g/mol. Its IUPAC name is N-[4-[1-(2-bicyclo[2.2.1]heptanyl)ethylsulfamoyl]phenyl]-2-chloro-4-fluorobenzamide.
| Compound Name | N-[4-[1-(2-bicyclo[2.2.1]heptanyl)ethylsulfamoyl]phenyl]-2-chloro-4-fluorobenzamide |
|---|---|
| PubChem CID | 43007741 |
| Molecular Formula | C22H24ClFN2O3S |
| Molecular Weight | 450.96 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | N-[4-[1-(2-bicyclo[2.2.1]heptanyl)ethylsulfamoyl]phenyl]-2-chloro-4-fluorobenzamide |
| SMILES | CC(NS(=O)(=O)c1ccc(NC(=O)c2ccc(F)cc2Cl)cc1)C1CC2CCC1C2 |
| InChI | InChI=1S/C22H24ClFN2O3S/c1-13(20-11-14-2-3-15(20)10-14)26-30(28,29)18-7-5-17(6-8-18)25-22(27)19-9-4-16(24)12-21(19)23/h4-9,12-15,20,26H,2-3,10-11H2,1H3,(H,25,27) |
| InChIKey | KPQZBINCSLKWPI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.96 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |