C17H23N5O5S2 — CID 43008060
ethyl 2-[[5-[[2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 43008060) has the molecular formula C17H23N5O5S2 and a molecular weight of 441.54 g/mol. Its IUPAC name is ethyl 2-[[5-[[2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[[2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 43008060 |
| Molecular Formula | C17H23N5O5S2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | ethyl 2-[[5-[[2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)CN2C(=O)NC3(CCCCC3C)C2=O)s1 |
| InChI | InChI=1S/C17H23N5O5S2/c1-3-27-12(24)9-28-16-21-20-14(29-16)18-11(23)8-22-13(25)17(19-15(22)26)7-5-4-6-10(17)2/h10H,3-9H2,1-2H3,(H,19,26)(H,18,20,23) |
| InChIKey | WODNQDAJGDLHCX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|