C19H19N5O6S2 — CID 51565092
ethyl 2-[[5-[[2-[(4R)-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-1'-yl]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 51565092) has the molecular formula C19H19N5O6S2 and a molecular weight of 477.52 g/mol. Its IUPAC name is ethyl 2-[[5-[[2-[(4R)-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-1'-yl]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[[2-[(4R)-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-1'-yl]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 51565092 |
| Molecular Formula | C19H19N5O6S2 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | ethyl 2-[[5-[[2-[(4R)-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-1'-yl]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)CN2C(=O)N[C@@]3(CCOc4ccccc43)C2=O)s1 |
| InChI | InChI=1S/C19H19N5O6S2/c1-2-29-14(26)10-31-18-23-22-16(32-18)20-13(25)9-24-15(27)19(21-17(24)28)7-8-30-12-6-4-3-5-11(12)19/h3-6H,2,7-10H2,1H3,(H,21,28)(H,20,22,25)/t19-/m1/s1 |
| InChIKey | CYDJARUSRDLSHS-LJQANCHMSA-N |
| XLogP | 1.36 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|