C19H23N3O5 — CID 43011898
methyl 2-[1-(1-benzyl-5-oxopyrrolidine-3-carbonyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 43011898) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is methyl 2-[1-(1-benzyl-5-oxopyrrolidine-3-carbonyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | methyl 2-[1-(1-benzyl-5-oxopyrrolidine-3-carbonyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 43011898 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | methyl 2-[1-(1-benzyl-5-oxopyrrolidine-3-carbonyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | COC(=O)CC1C(=O)NCCN1C(=O)C1CC(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H23N3O5/c1-27-17(24)10-15-18(25)20-7-8-22(15)19(26)14-9-16(23)21(12-14)11-13-5-3-2-4-6-13/h2-6,14-15H,7-12H2,1H3,(H,20,25) |
| InChIKey | NTAUTMXHTSIRFI-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |