C18H20BrFN2O4 — CID 43012192
2-methoxyethyl 6-(5-bromo-2-fluorophenyl)-3-cyclopropyl-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 43012192) has the molecular formula C18H20BrFN2O4 and a molecular weight of 427.27 g/mol. Its IUPAC name is 2-methoxyethyl 6-(5-bromo-2-fluorophenyl)-3-cyclopropyl-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | 2-methoxyethyl 6-(5-bromo-2-fluorophenyl)-3-cyclopropyl-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 43012192 |
| Molecular Formula | C18H20BrFN2O4 |
| Molecular Weight | 427.27 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 2-methoxyethyl 6-(5-bromo-2-fluorophenyl)-3-cyclopropyl-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)N(C2CC2)C(=O)NC1c1cc(Br)ccc1F |
| InChI | InChI=1S/C18H20BrFN2O4/c1-10-15(17(23)26-8-7-25-2)16(13-9-11(19)3-6-14(13)20)21-18(24)22(10)12-4-5-12/h3,6,9,12,16H,4-5,7-8H2,1-2H3,(H,21,24) |
| InChIKey | ZKEQGJRNLHLGFF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|