C24H33N3O5S — CID 43013459
2-(2,6-dimethylmorpholin-4-yl)-1-[2,5-dimethyl-1-(3-morpholin-4-ylsulfonylphenyl)pyrrol-3-yl]ethanone (PubChem CID 43013459) has the molecular formula C24H33N3O5S and a molecular weight of 475.61 g/mol. Its IUPAC name is 2-(2,6-dimethylmorpholin-4-yl)-1-[2,5-dimethyl-1-(3-morpholin-4-ylsulfonylphenyl)pyrrol-3-yl]ethanone.
| Compound Name | 2-(2,6-dimethylmorpholin-4-yl)-1-[2,5-dimethyl-1-(3-morpholin-4-ylsulfonylphenyl)pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 43013459 |
| Molecular Formula | C24H33N3O5S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 2-(2,6-dimethylmorpholin-4-yl)-1-[2,5-dimethyl-1-(3-morpholin-4-ylsulfonylphenyl)pyrrol-3-yl]ethanone |
| SMILES | Cc1cc(C(=O)CN2CC(C)OC(C)C2)c(C)n1-c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C24H33N3O5S/c1-17-12-23(24(28)16-25-14-18(2)32-19(3)15-25)20(4)27(17)21-6-5-7-22(13-21)33(29,30)26-8-10-31-11-9-26/h5-7,12-13,18-19H,8-11,14-16H2,1-4H3 |
| InChIKey | NNLOEJOSWCCQBP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|