C15H17FN2O4S2 — CID 43015514
3-[[5-[2-(2-fluorophenoxy)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]methyl]thiolane 1,1-dioxide (PubChem CID 43015514) has the molecular formula C15H17FN2O4S2 and a molecular weight of 372.44 g/mol. Its IUPAC name is 3-[[5-[2-(2-fluorophenoxy)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]methyl]thiolane 1,1-dioxide.
| Compound Name | 3-[[5-[2-(2-fluorophenoxy)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]methyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 43015514 |
| Molecular Formula | C15H17FN2O4S2 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 3-[[5-[2-(2-fluorophenoxy)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]methyl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(Cc2nnc(SCCOc3ccccc3F)o2)C1 |
| InChI | InChI=1S/C15H17FN2O4S2/c16-12-3-1-2-4-13(12)21-6-7-23-15-18-17-14(22-15)9-11-5-8-24(19,20)10-11/h1-4,11H,5-10H2 |
| InChIKey | SIAWNNGHBFJSAM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|