C21H19N3O3S2 — CID 46626526
3-[[5-(phenanthridin-6-ylmethylsulfanyl)-1,3,4-oxadiazol-2-yl]methyl]thiolane 1,1-dioxide (PubChem CID 46626526) has the molecular formula C21H19N3O3S2 and a molecular weight of 425.54 g/mol. Its IUPAC name is 3-[[5-(phenanthridin-6-ylmethylsulfanyl)-1,3,4-oxadiazol-2-yl]methyl]thiolane 1,1-dioxide.
| Compound Name | 3-[[5-(phenanthridin-6-ylmethylsulfanyl)-1,3,4-oxadiazol-2-yl]methyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 46626526 |
| Molecular Formula | C21H19N3O3S2 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 3-[[5-(phenanthridin-6-ylmethylsulfanyl)-1,3,4-oxadiazol-2-yl]methyl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(Cc2nnc(SCc3nc4ccccc4c4ccccc34)o2)C1 |
| InChI | InChI=1S/C21H19N3O3S2/c25-29(26)10-9-14(13-29)11-20-23-24-21(27-20)28-12-19-17-7-2-1-5-15(17)16-6-3-4-8-18(16)22-19/h1-8,14H,9-13H2 |
| InChIKey | GKAHEVPJUKYSKB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 85.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|