C24H27N3O6S — CID 43015711
[1-[4-(benzenesulfonyl)piperazin-1-yl]-1-oxopropan-2-yl] 3-(2-oxopyrrolidin-1-yl)benzoate (PubChem CID 43015711) has the molecular formula C24H27N3O6S and a molecular weight of 485.56 g/mol. Its IUPAC name is [1-[4-(benzenesulfonyl)piperazin-1-yl]-1-oxopropan-2-yl] 3-(2-oxopyrrolidin-1-yl)benzoate.
| Compound Name | [1-[4-(benzenesulfonyl)piperazin-1-yl]-1-oxopropan-2-yl] 3-(2-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 43015711 |
| Molecular Formula | C24H27N3O6S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | [1-[4-(benzenesulfonyl)piperazin-1-yl]-1-oxopropan-2-yl] 3-(2-oxopyrrolidin-1-yl)benzoate |
| SMILES | CC(OC(=O)c1cccc(N2CCCC2=O)c1)C(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H27N3O6S/c1-18(33-24(30)19-7-5-8-20(17-19)27-12-6-11-22(27)28)23(29)25-13-15-26(16-14-25)34(31,32)21-9-3-2-4-10-21/h2-5,7-10,17-18H,6,11-16H2,1H3 |
| InChIKey | CQBSVGLULMSAEI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |