About ethyl 3-[2-(2,6-dimethylmorpholin-4-yl)propanoylamino]-5-fluoro-1H-indole-2-carboxylate
ethyl 3-[2-(2,6-dimethylmorpholin-4-yl)propanoylamino]-5-fluoro-1H-indole-2-carboxylate (PubChem CID 4301589) has the molecular formula C20H26FN3O4
and a molecular weight of 391.44 g/mol. Its IUPAC name is ethyl 3-[2-(2,6-dimethylmorpholin-4-yl)propanoylamino]-5-fluoro-1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-[2-(2,6-dimethylmorpholin-4-yl)propanoylamino]-5-fluoro-1H-indole-2-carboxylate |
| PubChem CID | 4301589 |
| Molecular Formula | C20H26FN3O4 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | ethyl 3-[2-(2,6-dimethylmorpholin-4-yl)propanoylamino]-5-fluoro-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccc(F)cc2c1NC(=O)C(C)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C20H26FN3O4/c1-5-27-20(26)18-17(15-8-14(21)6-7-16(15)22-18)23-19(25)13(4)24-9-11(2)28-12(3)10-24/h6-8,11-13,22H,5,9-10H2,1-4H3,(H,23,25) |
| InChIKey | WLIUZWVUOPRDGB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-[2-(2,6-dimethylmorpholin-4-yl)propanoylamino]-5-fluoro-1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[2-(2,6-dimethylmorpholin-4-yl)propanoylamino]-5-fluoro-1H-indole-2-carboxylate?
The IUPAC name of ethyl 3-[2-(2,6-dimethylmorpholin-4-yl)propanoylamino]-5-fluoro-1H-indole-2-carboxylate (CID 4301589) is ethyl 3-[2-(2,6-dimethylmorpholin-4-yl)propanoylamino]-5-fluoro-1H-indole-2-carboxylate.
What is the SMILES notation for ethyl 3-[2-(2,6-dimethylmorpholin-4-yl)propanoylamino]-5-fluoro-1H-indole-2-carboxylate?
The canonical SMILES for ethyl 3-[2-(2,6-dimethylmorpholin-4-yl)propanoylamino]-5-fluoro-1H-indole-2-carboxylate is CCOC(=O)c1[nH]c2ccc(F)cc2c1NC(=O)C(C)N1CC(C)OC(C)C1.
What is the InChIKey of ethyl 3-[2-(2,6-dimethylmorpholin-4-yl)propanoylamino]-5-fluoro-1H-indole-2-carboxylate?
The InChIKey is WLIUZWVUOPRDGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26FN3O4/c1-5-27-20(26)18-17(15-8-14(21)6-7-16(15)22-18)23-19(25)13(4)24-9-11(2)28-12(3)10-24/h6-8,11-13,22H,5,9-10H2,1-4H3,(H,23,25).
What are the key properties of ethyl 3-[2-(2,6-dimethylmorpholin-4-yl)propanoylamino]-5-fluoro-1H-indole-2-carboxylate?
ethyl 3-[2-(2,6-dimethylmorpholin-4-yl)propanoylamino]-5-fluoro-1H-indole-2-carboxylate has a molecular weight of 391.44 g/mol, XLogP of 2.92, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[2-(2,6-dimethylmorpholin-4-yl)propanoylamino]-5-fluoro-1H-indole-2-carboxylate is sourced from PubChem (CID 4301589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).