C26H31N3O5S — CID 43017221
N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-3-[(4-ethoxyphenyl)sulfonylamino]benzamide (PubChem CID 43017221) has the molecular formula C26H31N3O5S and a molecular weight of 497.62 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-3-[(4-ethoxyphenyl)sulfonylamino]benzamide.
| Compound Name | N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-3-[(4-ethoxyphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 43017221 |
| Molecular Formula | C26H31N3O5S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-3-[(4-ethoxyphenyl)sulfonylamino]benzamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cccc(C(=O)NCC(c3cccc(OC)c3)N(C)C)c2)cc1 |
| InChI | InChI=1S/C26H31N3O5S/c1-5-34-22-12-14-24(15-13-22)35(31,32)28-21-10-6-9-20(16-21)26(30)27-18-25(29(2)3)19-8-7-11-23(17-19)33-4/h6-17,25,28H,5,18H2,1-4H3,(H,27,30) |
| InChIKey | YKQAMDOJPOGFCS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |