C23H27N3O5S — CID 24542679
N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-[(4-ethoxyphenyl)sulfamoyl]benzamide (PubChem CID 24542679) has the molecular formula C23H27N3O5S and a molecular weight of 457.55 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-[(4-ethoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-[(4-ethoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 24542679 |
| Molecular Formula | C23H27N3O5S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-[(4-ethoxyphenyl)sulfamoyl]benzamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2cccc(C(=O)NCC(c3ccco3)N(C)C)c2)cc1 |
| InChI | InChI=1S/C23H27N3O5S/c1-4-30-19-12-10-18(11-13-19)25-32(28,29)20-8-5-7-17(15-20)23(27)24-16-21(26(2)3)22-9-6-14-31-22/h5-15,21,25H,4,16H2,1-3H3,(H,24,27) |
| InChIKey | PNTNWBCQLRMXJX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |