C26H31N3O5S — CID 25331234
3-[(4-ethoxyphenyl)sulfonylamino]-N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]benzamide (PubChem CID 25331234) has the molecular formula C26H31N3O5S and a molecular weight of 497.62 g/mol. Its IUPAC name is 3-[(4-ethoxyphenyl)sulfonylamino]-N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]benzamide.
| Compound Name | 3-[(4-ethoxyphenyl)sulfonylamino]-N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 25331234 |
| Molecular Formula | C26H31N3O5S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 3-[(4-ethoxyphenyl)sulfonylamino]-N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]benzamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cccc(C(=O)NC[C@H](c3ccco3)N3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C26H31N3O5S/c1-2-33-22-11-13-23(14-12-22)35(31,32)28-21-9-6-8-20(18-21)26(30)27-19-24(25-10-7-17-34-25)29-15-4-3-5-16-29/h6-14,17-18,24,28H,2-5,15-16,19H2,1H3,(H,27,30)/t24-/m1/s1 |
| InChIKey | YZIYZMMRXKDGEG-XMMPIXPASA-N |
| XLogP | 4.44 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |