C25H32ClN3O3 — CID 43017395
2-[1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-4-methyl-1-oxopentan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 43017395) has the molecular formula C25H32ClN3O3 and a molecular weight of 458.00 g/mol. Its IUPAC name is 2-[1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-4-methyl-1-oxopentan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-4-methyl-1-oxopentan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 43017395 |
| Molecular Formula | C25H32ClN3O3 |
| Molecular Weight | 458.00 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 2-[1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-4-methyl-1-oxopentan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC(C)CC(C(=O)N1CCN(Cc2cccc(Cl)c2)CC1)N1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C25H32ClN3O3/c1-17(2)14-22(29-23(30)20-8-3-4-9-21(20)24(29)31)25(32)28-12-10-27(11-13-28)16-18-6-5-7-19(26)15-18/h3-7,15,17,20-22H,8-14,16H2,1-2H3 |
| InChIKey | VRQZGLZXQCSJSI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.00 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|