C25H30FN3O4 — CID 46570587
2-[1-[4-(4-fluorobenzoyl)piperazin-1-yl]-4-methyl-1-oxopentan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 46570587) has the molecular formula C25H30FN3O4 and a molecular weight of 455.53 g/mol. Its IUPAC name is 2-[1-[4-(4-fluorobenzoyl)piperazin-1-yl]-4-methyl-1-oxopentan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[1-[4-(4-fluorobenzoyl)piperazin-1-yl]-4-methyl-1-oxopentan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 46570587 |
| Molecular Formula | C25H30FN3O4 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 2-[1-[4-(4-fluorobenzoyl)piperazin-1-yl]-4-methyl-1-oxopentan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC(C)CC(C(=O)N1CCN(C(=O)c2ccc(F)cc2)CC1)N1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C25H30FN3O4/c1-16(2)15-21(29-23(31)19-5-3-4-6-20(19)24(29)32)25(33)28-13-11-27(12-14-28)22(30)17-7-9-18(26)10-8-17/h3-4,7-10,16,19-21H,5-6,11-15H2,1-2H3 |
| InChIKey | APRPGJWJQAKZKD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|