C23H30ClN3O3S — CID 46654824
2-[1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-4-methyl-1-oxopentan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 46654824) has the molecular formula C23H30ClN3O3S and a molecular weight of 464.03 g/mol. Its IUPAC name is 2-[1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-4-methyl-1-oxopentan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-4-methyl-1-oxopentan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 46654824 |
| Molecular Formula | C23H30ClN3O3S |
| Molecular Weight | 464.03 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 2-[1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-4-methyl-1-oxopentan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC(C)CC(C(=O)N1CCN(Cc2ccc(Cl)s2)CC1)N1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C23H30ClN3O3S/c1-15(2)13-19(27-21(28)17-5-3-4-6-18(17)22(27)29)23(30)26-11-9-25(10-12-26)14-16-7-8-20(24)31-16/h3-4,7-8,15,17-19H,5-6,9-14H2,1-2H3 |
| InChIKey | HDXLKJOKHNMGOG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.03 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|