C28H34N2O — CID 4301824
N-(9-ethylcarbazol-3-yl)-3,5,7-trimethyladamantane-1-carboxamide (PubChem CID 4301824) has the molecular formula C28H34N2O and a molecular weight of 414.59 g/mol. Its IUPAC name is N-(9-ethylcarbazol-3-yl)-3,5,7-trimethyladamantane-1-carboxamide.
| Compound Name | N-(9-ethylcarbazol-3-yl)-3,5,7-trimethyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 4301824 |
| Molecular Formula | C28H34N2O |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | N-(9-ethylcarbazol-3-yl)-3,5,7-trimethyladamantane-1-carboxamide |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)C34CC5(C)CC(C)(CC(C)(C5)C3)C4)ccc21 |
| InChI | InChI=1S/C28H34N2O/c1-5-30-22-9-7-6-8-20(22)21-12-19(10-11-23(21)30)29-24(31)28-16-25(2)13-26(3,17-28)15-27(4,14-25)18-28/h6-12H,5,13-18H2,1-4H3,(H,29,31) |
| InChIKey | MFVWQGMODRGDHG-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |