C24H30N4O4S — CID 43020036
N,N-dimethyl-2-[4-[3-[phenyl(prop-2-enyl)sulfamoyl]benzoyl]piperazin-1-yl]acetamide (PubChem CID 43020036) has the molecular formula C24H30N4O4S and a molecular weight of 470.60 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-[3-[phenyl(prop-2-enyl)sulfamoyl]benzoyl]piperazin-1-yl]acetamide.
| Compound Name | N,N-dimethyl-2-[4-[3-[phenyl(prop-2-enyl)sulfamoyl]benzoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 43020036 |
| Molecular Formula | C24H30N4O4S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | N,N-dimethyl-2-[4-[3-[phenyl(prop-2-enyl)sulfamoyl]benzoyl]piperazin-1-yl]acetamide |
| SMILES | C=CCN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)N2CCN(CC(=O)N(C)C)CC2)c1 |
| InChI | InChI=1S/C24H30N4O4S/c1-4-13-28(21-10-6-5-7-11-21)33(31,32)22-12-8-9-20(18-22)24(30)27-16-14-26(15-17-27)19-23(29)25(2)3/h4-12,18H,1,13-17,19H2,2-3H3 |
| InChIKey | WZRGXFMYVAOORM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|