C19H24N2O2 — CID 4302043
1-cyclopentyl-4-cyclopropyl-3-(4-methylphenyl)piperazine-2,5-dione (PubChem CID 4302043) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-cyclopentyl-4-cyclopropyl-3-(4-methylphenyl)piperazine-2,5-dione.
| Compound Name | 1-cyclopentyl-4-cyclopropyl-3-(4-methylphenyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 4302043 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 1-cyclopentyl-4-cyclopropyl-3-(4-methylphenyl)piperazine-2,5-dione |
| SMILES | Cc1ccc(C2C(=O)N(C3CCCC3)CC(=O)N2C2CC2)cc1 |
| InChI | InChI=1S/C19H24N2O2/c1-13-6-8-14(9-7-13)18-19(23)20(15-4-2-3-5-15)12-17(22)21(18)16-10-11-16/h6-9,15-16,18H,2-5,10-12H2,1H3 |
| InChIKey | YVSGPBOJSUWXCF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |