C21H26N2O3 — CID 127049852
6-benzoyl-9-cyclohexyl-6,9-diazaspiro[4.5]decane-8,10-dione (PubChem CID 127049852) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 6-benzoyl-9-cyclohexyl-6,9-diazaspiro[4.5]decane-8,10-dione.
| Compound Name | 6-benzoyl-9-cyclohexyl-6,9-diazaspiro[4.5]decane-8,10-dione |
|---|---|
| PubChem CID | 127049852 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 6-benzoyl-9-cyclohexyl-6,9-diazaspiro[4.5]decane-8,10-dione |
| SMILES | O=C1CN(C(=O)c2ccccc2)C2(CCCC2)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C21H26N2O3/c24-18-15-22(19(25)16-9-3-1-4-10-16)21(13-7-8-14-21)20(26)23(18)17-11-5-2-6-12-17/h1,3-4,9-10,17H,2,5-8,11-15H2 |
| InChIKey | YOVRBAYQBRCCLG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|