C23H23N3O3 — CID 70610780
(2Z)-2-(3-cyclohexyl-2,5-dioxo-1-phenylimidazolidin-4-ylidene)-2-phenylacetamide (PubChem CID 70610780) has the molecular formula C23H23N3O3 and a molecular weight of 389.45 g/mol. Its IUPAC name is (2Z)-2-(3-cyclohexyl-2,5-dioxo-1-phenylimidazolidin-4-ylidene)-2-phenylacetamide.
| Compound Name | (2Z)-2-(3-cyclohexyl-2,5-dioxo-1-phenylimidazolidin-4-ylidene)-2-phenylacetamide |
|---|---|
| PubChem CID | 70610780 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | (2Z)-2-(3-cyclohexyl-2,5-dioxo-1-phenylimidazolidin-4-ylidene)-2-phenylacetamide |
| SMILES | NC(=O)/C(=C1/C(=O)N(c2ccccc2)C(=O)N1C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C23H23N3O3/c24-21(27)19(16-10-4-1-5-11-16)20-22(28)26(18-14-8-3-9-15-18)23(29)25(20)17-12-6-2-7-13-17/h1,3-5,8-11,14-15,17H,2,6-7,12-13H2,(H2,24,27)/b20-19- |
| InChIKey | WTRIZCSTLHYCRP-VXPUYCOJSA-N |
| XLogP | 3.68 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|