C16H16N2O4 — CID 67910634
5-acetyl-1-cyclopropyl-5-methyl-3-phenyl-1,3-diazinane-2,4,6-trione (PubChem CID 67910634) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is 5-acetyl-1-cyclopropyl-5-methyl-3-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-acetyl-1-cyclopropyl-5-methyl-3-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 67910634 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 5-acetyl-1-cyclopropyl-5-methyl-3-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | CC(=O)C1(C)C(=O)N(c2ccccc2)C(=O)N(C2CC2)C1=O |
| InChI | InChI=1S/C16H16N2O4/c1-10(19)16(2)13(20)17(11-6-4-3-5-7-11)15(22)18(14(16)21)12-8-9-12/h3-7,12H,8-9H2,1-2H3 |
| InChIKey | IADJCMBEDCZXTB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|