C24H30N4O3 — CID 7361016
1-[(4S)-1-cyclohexyl-5,5-dimethyl-2-oxo-3-phenylimidazolidin-4-yl]-1-hydroxy-3-phenylurea (PubChem CID 7361016) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is 1-[(4S)-1-cyclohexyl-5,5-dimethyl-2-oxo-3-phenylimidazolidin-4-yl]-1-hydroxy-3-phenylurea.
| Compound Name | 1-[(4S)-1-cyclohexyl-5,5-dimethyl-2-oxo-3-phenylimidazolidin-4-yl]-1-hydroxy-3-phenylurea |
|---|---|
| PubChem CID | 7361016 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 1-[(4S)-1-cyclohexyl-5,5-dimethyl-2-oxo-3-phenylimidazolidin-4-yl]-1-hydroxy-3-phenylurea |
| SMILES | CC1(C)[C@H](N(O)C(=O)Nc2ccccc2)N(c2ccccc2)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C24H30N4O3/c1-24(2)21(28(31)22(29)25-18-12-6-3-7-13-18)26(19-14-8-4-9-15-19)23(30)27(24)20-16-10-5-11-17-20/h3-4,6-9,12-15,20-21,31H,5,10-11,16-17H2,1-2H3,(H,25,29)/t21-/m0/s1 |
| InChIKey | CMKKVPGWDBSNHR-NRFANRHFSA-N |
| XLogP | 5.29 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|