C26H34N4O3 — CID 4623506
1-[1-cyclohexyl-5,5-dimethyl-3-(2-methylphenyl)-2-oxoimidazolidin-4-yl]-1-hydroxy-3-(2-methylphenyl)urea (PubChem CID 4623506) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is 1-[1-cyclohexyl-5,5-dimethyl-3-(2-methylphenyl)-2-oxoimidazolidin-4-yl]-1-hydroxy-3-(2-methylphenyl)urea.
| Compound Name | 1-[1-cyclohexyl-5,5-dimethyl-3-(2-methylphenyl)-2-oxoimidazolidin-4-yl]-1-hydroxy-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 4623506 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 1-[1-cyclohexyl-5,5-dimethyl-3-(2-methylphenyl)-2-oxoimidazolidin-4-yl]-1-hydroxy-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)N(O)C1N(c2ccccc2C)C(=O)N(C2CCCCC2)C1(C)C |
| InChI | InChI=1S/C26H34N4O3/c1-18-12-8-10-16-21(18)27-24(31)30(33)23-26(3,4)29(20-14-6-5-7-15-20)25(32)28(23)22-17-11-9-13-19(22)2/h8-13,16-17,20,23,33H,5-7,14-15H2,1-4H3,(H,27,31) |
| InChIKey | QWWJJMCXFNDTHS-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|