C24H28N2O6 — CID 43023064
[2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)-2-oxoethyl] 4-butoxy-3-methoxybenzoate (PubChem CID 43023064) has the molecular formula C24H28N2O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is [2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)-2-oxoethyl] 4-butoxy-3-methoxybenzoate.
| Compound Name | [2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)-2-oxoethyl] 4-butoxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 43023064 |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | [2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)-2-oxoethyl] 4-butoxy-3-methoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)OCC(=O)N2c3ccccc3NC(=O)CC2C)cc1OC |
| InChI | InChI=1S/C24H28N2O6/c1-4-5-12-31-20-11-10-17(14-21(20)30-3)24(29)32-15-23(28)26-16(2)13-22(27)25-18-8-6-7-9-19(18)26/h6-11,14,16H,4-5,12-13,15H2,1-3H3,(H,25,27) |
| InChIKey | RVIOTAUBSSOXCP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|