C23H25ClN2O5 — CID 46805913
[2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)-2-oxoethyl] 4-(4-chloro-2-methylphenoxy)butanoate (PubChem CID 46805913) has the molecular formula C23H25ClN2O5 and a molecular weight of 444.92 g/mol. Its IUPAC name is [2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)-2-oxoethyl] 4-(4-chloro-2-methylphenoxy)butanoate.
| Compound Name | [2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)-2-oxoethyl] 4-(4-chloro-2-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 46805913 |
| Molecular Formula | C23H25ClN2O5 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | [2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)-2-oxoethyl] 4-(4-chloro-2-methylphenoxy)butanoate |
| SMILES | Cc1cc(Cl)ccc1OCCCC(=O)OCC(=O)N1c2ccccc2NC(=O)CC1C |
| InChI | InChI=1S/C23H25ClN2O5/c1-15-12-17(24)9-10-20(15)30-11-5-8-23(29)31-14-22(28)26-16(2)13-21(27)25-18-6-3-4-7-19(18)26/h3-4,6-7,9-10,12,16H,5,8,11,13-14H2,1-2H3,(H,25,27) |
| InChIKey | GWSOYVDGRGZLMT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|