C25H22N2O6 — CID 43024704
N-(4-benzamido-2,5-dimethoxyphenyl)-1-oxo-3,4-dihydroisochromene-3-carboxamide (PubChem CID 43024704) has the molecular formula C25H22N2O6 and a molecular weight of 446.46 g/mol. Its IUPAC name is N-(4-benzamido-2,5-dimethoxyphenyl)-1-oxo-3,4-dihydroisochromene-3-carboxamide.
| Compound Name | N-(4-benzamido-2,5-dimethoxyphenyl)-1-oxo-3,4-dihydroisochromene-3-carboxamide |
|---|---|
| PubChem CID | 43024704 |
| Molecular Formula | C25H22N2O6 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | N-(4-benzamido-2,5-dimethoxyphenyl)-1-oxo-3,4-dihydroisochromene-3-carboxamide |
| SMILES | COc1cc(NC(=O)C2Cc3ccccc3C(=O)O2)c(OC)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H22N2O6/c1-31-20-14-19(21(32-2)13-18(20)26-23(28)15-8-4-3-5-9-15)27-24(29)22-12-16-10-6-7-11-17(16)25(30)33-22/h3-11,13-14,22H,12H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | RGLCVXDCMXQNBU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |