C19H21F2NO2 — CID 43024778
2-(4-tert-butylphenoxy)-N-(2,5-difluorophenyl)propanamide (PubChem CID 43024778) has the molecular formula C19H21F2NO2 and a molecular weight of 333.38 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-(2,5-difluorophenyl)propanamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-(2,5-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 43024778 |
| Molecular Formula | C19H21F2NO2 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-(2,5-difluorophenyl)propanamide |
| SMILES | CC(Oc1ccc(C(C)(C)C)cc1)C(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C19H21F2NO2/c1-12(18(23)22-17-11-14(20)7-10-16(17)21)24-15-8-5-13(6-9-15)19(2,3)4/h5-12H,1-4H3,(H,22,23) |
| InChIKey | URCWSLDMBBEKSH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |