C17H18FNO2S — CID 86918507
N-(5-fluoro-2-methylphenyl)-2-(4-methylsulfanylphenoxy)propanamide (PubChem CID 86918507) has the molecular formula C17H18FNO2S and a molecular weight of 319.40 g/mol. Its IUPAC name is N-(5-fluoro-2-methylphenyl)-2-(4-methylsulfanylphenoxy)propanamide.
| Compound Name | N-(5-fluoro-2-methylphenyl)-2-(4-methylsulfanylphenoxy)propanamide |
|---|---|
| PubChem CID | 86918507 |
| Molecular Formula | C17H18FNO2S |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-(5-fluoro-2-methylphenyl)-2-(4-methylsulfanylphenoxy)propanamide |
| SMILES | CSc1ccc(OC(C)C(=O)Nc2cc(F)ccc2C)cc1 |
| InChI | InChI=1S/C17H18FNO2S/c1-11-4-5-13(18)10-16(11)19-17(20)12(2)21-14-6-8-15(22-3)9-7-14/h4-10,12H,1-3H3,(H,19,20) |
| InChIKey | NSIXIVRYGXSAGT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |