C22H21N3O5S — CID 43027218
[2-(2-nitroanilino)-2-oxoethyl] 1-(1,3-benzothiazol-2-ylmethyl)cyclopentane-1-carboxylate (PubChem CID 43027218) has the molecular formula C22H21N3O5S and a molecular weight of 439.49 g/mol. Its IUPAC name is [2-(2-nitroanilino)-2-oxoethyl] 1-(1,3-benzothiazol-2-ylmethyl)cyclopentane-1-carboxylate.
| Compound Name | [2-(2-nitroanilino)-2-oxoethyl] 1-(1,3-benzothiazol-2-ylmethyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 43027218 |
| Molecular Formula | C22H21N3O5S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | [2-(2-nitroanilino)-2-oxoethyl] 1-(1,3-benzothiazol-2-ylmethyl)cyclopentane-1-carboxylate |
| SMILES | O=C(COC(=O)C1(Cc2nc3ccccc3s2)CCCC1)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H21N3O5S/c26-19(23-15-7-1-3-9-17(15)25(28)29)14-30-21(27)22(11-5-6-12-22)13-20-24-16-8-2-4-10-18(16)31-20/h1-4,7-10H,5-6,11-14H2,(H,23,26) |
| InChIKey | YAMYDESDNWJJAK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|