C19H18IN3O3S — CID 43033294
1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-(4-iodophenyl)piperidine-3-carboxamide (PubChem CID 43033294) has the molecular formula C19H18IN3O3S and a molecular weight of 495.34 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-(4-iodophenyl)piperidine-3-carboxamide.
| Compound Name | 1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-(4-iodophenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43033294 |
| Molecular Formula | C19H18IN3O3S |
| Molecular Weight | 495.34 g/mol |
| Exact Mass | 495.01 |
| IUPAC Name | 1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-(4-iodophenyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(I)cc1)C1CCCN(C2=NS(=O)(=O)c3ccccc32)C1 |
| InChI | InChI=1S/C19H18IN3O3S/c20-14-7-9-15(10-8-14)21-19(24)13-4-3-11-23(12-13)18-16-5-1-2-6-17(16)27(25,26)22-18/h1-2,5-10,13H,3-4,11-12H2,(H,21,24) |
| InChIKey | UIZZCXOCWIZESN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|