C23H21N3O3S — CID 46610054
1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-naphthalen-1-ylpiperidine-3-carboxamide (PubChem CID 46610054) has the molecular formula C23H21N3O3S and a molecular weight of 419.51 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-naphthalen-1-ylpiperidine-3-carboxamide.
| Compound Name | 1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-naphthalen-1-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 46610054 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-naphthalen-1-ylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1cccc2ccccc12)C1CCCN(C2=NS(=O)(=O)c3ccccc32)C1 |
| InChI | InChI=1S/C23H21N3O3S/c27-23(24-20-12-5-8-16-7-1-2-10-18(16)20)17-9-6-14-26(15-17)22-19-11-3-4-13-21(19)30(28,29)25-22/h1-5,7-8,10-13,17H,6,9,14-15H2,(H,24,27) |
| InChIKey | UOSLABCRUZOSMX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |