C23H24N4O4S — CID 26003104
(3S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-[2-(prop-2-enylcarbamoyl)phenyl]piperidine-3-carboxamide (PubChem CID 26003104) has the molecular formula C23H24N4O4S and a molecular weight of 452.54 g/mol. Its IUPAC name is (3S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-[2-(prop-2-enylcarbamoyl)phenyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-[2-(prop-2-enylcarbamoyl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 26003104 |
| Molecular Formula | C23H24N4O4S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | (3S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-[2-(prop-2-enylcarbamoyl)phenyl]piperidine-3-carboxamide |
| SMILES | C=CCNC(=O)c1ccccc1NC(=O)[C@H]1CCCN(C2=NS(=O)(=O)c3ccccc32)C1 |
| InChI | InChI=1S/C23H24N4O4S/c1-2-13-24-23(29)17-9-3-5-11-19(17)25-22(28)16-8-7-14-27(15-16)21-18-10-4-6-12-20(18)32(30,31)26-21/h2-6,9-12,16H,1,7-8,13-15H2,(H,24,29)(H,25,28)/t16-/m0/s1 |
| InChIKey | XRONQNRHKILKEV-INIZCTEOSA-N |
| XLogP | 2.40 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|