C19H20N4O4S3 — CID 43034553
ethyl 2-[[5-[[2-[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 43034553) has the molecular formula C19H20N4O4S3 and a molecular weight of 464.59 g/mol. Its IUPAC name is ethyl 2-[[5-[[2-[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[[2-[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 43034553 |
| Molecular Formula | C19H20N4O4S3 |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | ethyl 2-[[5-[[2-[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)Cc2csc(COc3ccc(C)cc3)n2)s1 |
| InChI | InChI=1S/C19H20N4O4S3/c1-3-26-17(25)11-29-19-23-22-18(30-19)21-15(24)8-13-10-28-16(20-13)9-27-14-6-4-12(2)5-7-14/h4-7,10H,3,8-9,11H2,1-2H3,(H,21,22,24) |
| InChIKey | CMFNYPZGOLCVHK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|