C18H17ClN4O4S3 — CID 55445886
ethyl 2-[[5-[[2-[(4-chlorophenoxy)methyl]-4-methyl-1,3-thiazole-5-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 55445886) has the molecular formula C18H17ClN4O4S3 and a molecular weight of 485.01 g/mol. Its IUPAC name is ethyl 2-[[5-[[2-[(4-chlorophenoxy)methyl]-4-methyl-1,3-thiazole-5-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[[2-[(4-chlorophenoxy)methyl]-4-methyl-1,3-thiazole-5-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 55445886 |
| Molecular Formula | C18H17ClN4O4S3 |
| Molecular Weight | 485.01 g/mol |
| Exact Mass | 484.01 |
| IUPAC Name | ethyl 2-[[5-[[2-[(4-chlorophenoxy)methyl]-4-methyl-1,3-thiazole-5-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)c2sc(COc3ccc(Cl)cc3)nc2C)s1 |
| InChI | InChI=1S/C18H17ClN4O4S3/c1-3-26-14(24)9-28-18-23-22-17(30-18)21-16(25)15-10(2)20-13(29-15)8-27-12-6-4-11(19)5-7-12/h4-7H,3,8-9H2,1-2H3,(H,21,22,25) |
| InChIKey | JEZJJDAIDPQTEF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.01 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|