C19H20ClN5O3S2 — CID 55576070
ethyl 2-[[5-[[1-(4-chlorophenyl)-5-propan-2-ylpyrazole-4-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 55576070) has the molecular formula C19H20ClN5O3S2 and a molecular weight of 465.99 g/mol. Its IUPAC name is ethyl 2-[[5-[[1-(4-chlorophenyl)-5-propan-2-ylpyrazole-4-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[[1-(4-chlorophenyl)-5-propan-2-ylpyrazole-4-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 55576070 |
| Molecular Formula | C19H20ClN5O3S2 |
| Molecular Weight | 465.99 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | ethyl 2-[[5-[[1-(4-chlorophenyl)-5-propan-2-ylpyrazole-4-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)c2cnn(-c3ccc(Cl)cc3)c2C(C)C)s1 |
| InChI | InChI=1S/C19H20ClN5O3S2/c1-4-28-15(26)10-29-19-24-23-18(30-19)22-17(27)14-9-21-25(16(14)11(2)3)13-7-5-12(20)6-8-13/h5-9,11H,4,10H2,1-3H3,(H,22,23,27) |
| InChIKey | YRSPGLHHLZDEJT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.99 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|