C12H15N5O3S3 — CID 120616917
ethyl 2-[[5-[[2-(2-aminoethyl)-1,3-thiazole-4-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 120616917) has the molecular formula C12H15N5O3S3 and a molecular weight of 373.49 g/mol. Its IUPAC name is ethyl 2-[[5-[[2-(2-aminoethyl)-1,3-thiazole-4-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[[2-(2-aminoethyl)-1,3-thiazole-4-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 120616917 |
| Molecular Formula | C12H15N5O3S3 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | ethyl 2-[[5-[[2-(2-aminoethyl)-1,3-thiazole-4-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)c2csc(CCN)n2)s1 |
| InChI | InChI=1S/C12H15N5O3S3/c1-2-20-9(18)6-22-12-17-16-11(23-12)15-10(19)7-5-21-8(14-7)3-4-13/h5H,2-4,6,13H2,1H3,(H,15,16,19) |
| InChIKey | NQLKIKHBGCCKLW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|