C21H29N3O4 — CID 43035395
N-methyl-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-(4-methylphenoxy)ethyl]acetamide (PubChem CID 43035395) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is N-methyl-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-(4-methylphenoxy)ethyl]acetamide.
| Compound Name | N-methyl-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-(4-methylphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 43035395 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | N-methyl-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-(4-methylphenoxy)ethyl]acetamide |
| SMILES | Cc1ccc(OCCN(C)C(=O)CN2C(=O)NC3(CCCCC3C)C2=O)cc1 |
| InChI | InChI=1S/C21H29N3O4/c1-15-7-9-17(10-8-15)28-13-12-23(3)18(25)14-24-19(26)21(22-20(24)27)11-5-4-6-16(21)2/h7-10,16H,4-6,11-14H2,1-3H3,(H,22,27) |
| InChIKey | CYDMNJSXFJVIAW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|