C21H21N3O6 — CID 43035787
3-[4-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-4-oxobutyl]-6-nitro-1,3-benzoxazol-2-one (PubChem CID 43035787) has the molecular formula C21H21N3O6 and a molecular weight of 411.41 g/mol. Its IUPAC name is 3-[4-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-4-oxobutyl]-6-nitro-1,3-benzoxazol-2-one.
| Compound Name | 3-[4-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-4-oxobutyl]-6-nitro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 43035787 |
| Molecular Formula | C21H21N3O6 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 3-[4-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-4-oxobutyl]-6-nitro-1,3-benzoxazol-2-one |
| SMILES | COc1ccc2c(c1)CCCN2C(=O)CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C21H21N3O6/c1-29-16-7-9-17-14(12-16)4-2-10-22(17)20(25)5-3-11-23-18-8-6-15(24(27)28)13-19(18)30-21(23)26/h6-9,12-13H,2-5,10-11H2,1H3 |
| InChIKey | FLQKNMNEXGHXKU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 107.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|