C20H22N4O3 — CID 43036802
N-[4-[[5-methyl-2-(4-methylphenyl)pyrazol-3-yl]amino]-4-oxobutyl]furan-2-carboxamide (PubChem CID 43036802) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is N-[4-[[5-methyl-2-(4-methylphenyl)pyrazol-3-yl]amino]-4-oxobutyl]furan-2-carboxamide.
| Compound Name | N-[4-[[5-methyl-2-(4-methylphenyl)pyrazol-3-yl]amino]-4-oxobutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 43036802 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-[4-[[5-methyl-2-(4-methylphenyl)pyrazol-3-yl]amino]-4-oxobutyl]furan-2-carboxamide |
| SMILES | Cc1ccc(-n2nc(C)cc2NC(=O)CCCNC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C20H22N4O3/c1-14-7-9-16(10-8-14)24-18(13-15(2)23-24)22-19(25)6-3-11-21-20(26)17-5-4-12-27-17/h4-5,7-10,12-13H,3,6,11H2,1-2H3,(H,21,26)(H,22,25) |
| InChIKey | LTVXILPWHAXXCJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|