C21H21ClN4O5 — CID 4303769
4-chloro-N-cyclopropyl-N-[2-[[2-(3-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-3-nitrobenzamide (PubChem CID 4303769) has the molecular formula C21H21ClN4O5 and a molecular weight of 444.88 g/mol. Its IUPAC name is 4-chloro-N-cyclopropyl-N-[2-[[2-(3-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-cyclopropyl-N-[2-[[2-(3-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 4303769 |
| Molecular Formula | C21H21ClN4O5 |
| Molecular Weight | 444.88 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 4-chloro-N-cyclopropyl-N-[2-[[2-(3-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-3-nitrobenzamide |
| SMILES | Cc1cccc(NC(=O)CNC(=O)CN(C(=O)c2ccc(Cl)c([N+](=O)[O-])c2)C2CC2)c1 |
| InChI | InChI=1S/C21H21ClN4O5/c1-13-3-2-4-15(9-13)24-19(27)11-23-20(28)12-25(16-6-7-16)21(29)14-5-8-17(22)18(10-14)26(30)31/h2-5,8-10,16H,6-7,11-12H2,1H3,(H,23,28)(H,24,27) |
| InChIKey | HCMDHFXONDQNON-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.88 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|