C13H13N5O4 — CID 43039205
3-amino-N-[2-hydroxy-2-(4-nitrophenyl)ethyl]pyrazine-2-carboxamide (PubChem CID 43039205) has the molecular formula C13H13N5O4 and a molecular weight of 303.28 g/mol. Its IUPAC name is 3-amino-N-[2-hydroxy-2-(4-nitrophenyl)ethyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[2-hydroxy-2-(4-nitrophenyl)ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 43039205 |
| Molecular Formula | C13H13N5O4 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 3-amino-N-[2-hydroxy-2-(4-nitrophenyl)ethyl]pyrazine-2-carboxamide |
| SMILES | Nc1nccnc1C(=O)NCC(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H13N5O4/c14-12-11(15-5-6-16-12)13(20)17-7-10(19)8-1-3-9(4-2-8)18(21)22/h1-6,10,19H,7H2,(H2,14,16)(H,17,20) |
| InChIKey | YFNHWQVPUXGMNH-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|