C20H26N2O5 — CID 43040312
(2-amino-2-oxo-1-phenylethyl) 1-(2-morpholin-4-yl-2-oxoethyl)cyclopentane-1-carboxylate (PubChem CID 43040312) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is (2-amino-2-oxo-1-phenylethyl) 1-(2-morpholin-4-yl-2-oxoethyl)cyclopentane-1-carboxylate.
| Compound Name | (2-amino-2-oxo-1-phenylethyl) 1-(2-morpholin-4-yl-2-oxoethyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 43040312 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | (2-amino-2-oxo-1-phenylethyl) 1-(2-morpholin-4-yl-2-oxoethyl)cyclopentane-1-carboxylate |
| SMILES | NC(=O)C(OC(=O)C1(CC(=O)N2CCOCC2)CCCC1)c1ccccc1 |
| InChI | InChI=1S/C20H26N2O5/c21-18(24)17(15-6-2-1-3-7-15)27-19(25)20(8-4-5-9-20)14-16(23)22-10-12-26-13-11-22/h1-3,6-7,17H,4-5,8-14H2,(H2,21,24) |
| InChIKey | VEHPGEFGWONJIM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |