C15H20O3 — CID 70129621
[hydroxy(phenyl)methyl] 1-ethylcyclopentane-1-carboxylate (PubChem CID 70129621) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is [hydroxy(phenyl)methyl] 1-ethylcyclopentane-1-carboxylate.
| Compound Name | [hydroxy(phenyl)methyl] 1-ethylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 70129621 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | [hydroxy(phenyl)methyl] 1-ethylcyclopentane-1-carboxylate |
| SMILES | CCC1(C(=O)OC(O)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C15H20O3/c1-2-15(10-6-7-11-15)14(17)18-13(16)12-8-4-3-5-9-12/h3-5,8-9,13,16H,2,6-7,10-11H2,1H3 |
| InChIKey | BYJKUXKDZINNIO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|