C23H26O3 — CID 56991904
(3-oxo-2,5-diphenylpentyl) 1-ethylcyclopropane-1-carboxylate (PubChem CID 56991904) has the molecular formula C23H26O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is (3-oxo-2,5-diphenylpentyl) 1-ethylcyclopropane-1-carboxylate.
| Compound Name | (3-oxo-2,5-diphenylpentyl) 1-ethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 56991904 |
| Molecular Formula | C23H26O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | (3-oxo-2,5-diphenylpentyl) 1-ethylcyclopropane-1-carboxylate |
| SMILES | CCC1(C(=O)OCC(C(=O)CCc2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H26O3/c1-2-23(15-16-23)22(25)26-17-20(19-11-7-4-8-12-19)21(24)14-13-18-9-5-3-6-10-18/h3-12,20H,2,13-17H2,1H3 |
| InChIKey | GZAIJXMVXCNHRM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |